C27H21F3N2O2 — CID 59194004
N-(2-cyanoethyl)-3-[3-methyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzofuran-7-yl]benzamide (PubChem CID 59194004) has the molecular formula C27H21F3N2O2 and a molecular weight of 462.47 g/mol. Its IUPAC name is N-(2-cyanoethyl)-3-[3-methyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzofuran-7-yl]benzamide.
| Compound Name | N-(2-cyanoethyl)-3-[3-methyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzofuran-7-yl]benzamide |
|---|---|
| PubChem CID | 59194004 |
| Molecular Formula | C27H21F3N2O2 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | N-(2-cyanoethyl)-3-[3-methyl-2-[[3-(trifluoromethyl)phenyl]methyl]-1-benzofuran-7-yl]benzamide |
| SMILES | Cc1c(Cc2cccc(C(F)(F)F)c2)oc2c(-c3cccc(C(=O)NCCC#N)c3)cccc12 |
| InChI | InChI=1S/C27H21F3N2O2/c1-17-22-10-4-11-23(19-7-3-8-20(16-19)26(33)32-13-5-12-31)25(22)34-24(17)15-18-6-2-9-21(14-18)27(28,29)30/h2-4,6-11,14,16H,5,13,15H2,1H3,(H,32,33) |
| InChIKey | VBGYPCCZCGRSAZ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|