C10H18O4 — CID 59196931
(3-methyloxetan-3-yl)methyl 4-methoxybutanoate (PubChem CID 59196931) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is (3-methyloxetan-3-yl)methyl 4-methoxybutanoate.
| Compound Name | (3-methyloxetan-3-yl)methyl 4-methoxybutanoate |
|---|---|
| PubChem CID | 59196931 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (3-methyloxetan-3-yl)methyl 4-methoxybutanoate |
| SMILES | COCCCC(=O)OCC1(C)COC1 |
| InChI | InChI=1S/C10H18O4/c1-10(6-13-7-10)8-14-9(11)4-3-5-12-2/h3-8H2,1-2H3 |
| InChIKey | DJTVOKYVXXWEME-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|