C15H12INO3 — CID 59200646
3-iodo-6-methoxy-2-(4-methoxyphenyl)furo[3,2-b]pyridine (PubChem CID 59200646) has the molecular formula C15H12INO3 and a molecular weight of 381.17 g/mol. Its IUPAC name is 3-iodo-6-methoxy-2-(4-methoxyphenyl)furo[3,2-b]pyridine.
| Compound Name | 3-iodo-6-methoxy-2-(4-methoxyphenyl)furo[3,2-b]pyridine |
|---|---|
| PubChem CID | 59200646 |
| Molecular Formula | C15H12INO3 |
| Molecular Weight | 381.17 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | 3-iodo-6-methoxy-2-(4-methoxyphenyl)furo[3,2-b]pyridine |
| SMILES | COc1ccc(-c2oc3cc(OC)cnc3c2I)cc1 |
| InChI | InChI=1S/C15H12INO3/c1-18-10-5-3-9(4-6-10)15-13(16)14-12(20-15)7-11(19-2)8-17-14/h3-8H,1-2H3 |
| InChIKey | LAHPCXYWAGMXQG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.17 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|