About 5-hydroxy-2-(2-phenyl-4,5-dihydrobenzo[e]indol-3-yl)pyridine-4-carboxylic acid
5-hydroxy-2-(2-phenyl-4,5-dihydrobenzo[e]indol-3-yl)pyridine-4-carboxylic acid (PubChem CID 59214695) has the molecular formula C24H18N2O3
and a molecular weight of 382.42 g/mol. Its IUPAC name is 5-hydroxy-2-(2-phenyl-4,5-dihydrobenzo[e]indol-3-yl)pyridine-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-hydroxy-2-(2-phenyl-4,5-dihydrobenzo[e]indol-3-yl)pyridine-4-carboxylic acid |
| PubChem CID | 59214695 |
| Molecular Formula | C24H18N2O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 5-hydroxy-2-(2-phenyl-4,5-dihydrobenzo[e]indol-3-yl)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(-n2c(-c3ccccc3)cc3c2CCc2ccccc2-3)ncc1O |
| InChI | InChI=1S/C24H18N2O3/c27-22-14-25-23(13-19(22)24(28)29)26-20-11-10-15-6-4-5-9-17(15)18(20)12-21(26)16-7-2-1-3-8-16/h1-9,12-14,27H,10-11H2,(H,28,29) |
| InChIKey | CAHSFHRYKPUGBV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-2-(2-phenyl-4,5-dihydrobenzo[e]indol-3-yl)pyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2-(2-phenyl-4,5-dihydrobenzo[e]indol-3-yl)pyridine-4-carboxylic acid?
The IUPAC name of 5-hydroxy-2-(2-phenyl-4,5-dihydrobenzo[e]indol-3-yl)pyridine-4-carboxylic acid (CID 59214695) is 5-hydroxy-2-(2-phenyl-4,5-dihydrobenzo[e]indol-3-yl)pyridine-4-carboxylic acid.
What is the SMILES notation for 5-hydroxy-2-(2-phenyl-4,5-dihydrobenzo[e]indol-3-yl)pyridine-4-carboxylic acid?
The canonical SMILES for 5-hydroxy-2-(2-phenyl-4,5-dihydrobenzo[e]indol-3-yl)pyridine-4-carboxylic acid is O=C(O)c1cc(-n2c(-c3ccccc3)cc3c2CCc2ccccc2-3)ncc1O.
What is the InChIKey of 5-hydroxy-2-(2-phenyl-4,5-dihydrobenzo[e]indol-3-yl)pyridine-4-carboxylic acid?
The InChIKey is CAHSFHRYKPUGBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H18N2O3/c27-22-14-25-23(13-19(22)24(28)29)26-20-11-10-15-6-4-5-9-17(15)18(20)12-21(26)16-7-2-1-3-8-16/h1-9,12-14,27H,10-11H2,(H,28,29).
What are the key properties of 5-hydroxy-2-(2-phenyl-4,5-dihydrobenzo[e]indol-3-yl)pyridine-4-carboxylic acid?
5-hydroxy-2-(2-phenyl-4,5-dihydrobenzo[e]indol-3-yl)pyridine-4-carboxylic acid has a molecular weight of 382.42 g/mol, XLogP of 4.71, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2-(2-phenyl-4,5-dihydrobenzo[e]indol-3-yl)pyridine-4-carboxylic acid is sourced from PubChem (CID 59214695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).