C13H13Br3O3SSi — CID 59243912
trimethoxy-[4-(3,4,5-tribromothiophen-2-yl)phenyl]silane (PubChem CID 59243912) has the molecular formula C13H13Br3O3SSi and a molecular weight of 517.11 g/mol. Its IUPAC name is trimethoxy-[4-(3,4,5-tribromothiophen-2-yl)phenyl]silane.
| Compound Name | trimethoxy-[4-(3,4,5-tribromothiophen-2-yl)phenyl]silane |
|---|---|
| PubChem CID | 59243912 |
| Molecular Formula | C13H13Br3O3SSi |
| Molecular Weight | 517.11 g/mol |
| Exact Mass | 513.79 |
| IUPAC Name | trimethoxy-[4-(3,4,5-tribromothiophen-2-yl)phenyl]silane |
| SMILES | CO[Si](OC)(OC)c1ccc(-c2sc(Br)c(Br)c2Br)cc1 |
| InChI | InChI=1S/C13H13Br3O3SSi/c1-17-21(18-2,19-3)9-6-4-8(5-7-9)12-10(14)11(15)13(16)20-12/h4-7H,1-3H3 |
| InChIKey | TUZVWUGEJFLDPC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.11 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|