C20H12Se — CID 59245745
12-selenapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene (PubChem CID 59245745) has the molecular formula C20H12Se and a molecular weight of 331.28 g/mol. Its IUPAC name is 12-selenapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene.
| Compound Name | 12-selenapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene |
|---|---|
| PubChem CID | 59245745 |
| Molecular Formula | C20H12Se |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 12-selenapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene |
| SMILES | c1ccc2c(c1)ccc1c3ccc4ccccc4c3[se]c21 |
| InChI | InChI=1S/C20H12Se/c1-3-7-15-13(5-1)9-11-17-18-12-10-14-6-2-4-8-16(14)20(18)21-19(15)17/h1-12H |
| InChIKey | NBHFOBWZLUTQFQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|