C16H15N3O7 — CID 59248170
(2,5-dioxopyrrolidin-1-yl) (2S)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]pent-4-ynoate (PubChem CID 59248170) has the molecular formula C16H15N3O7 and a molecular weight of 361.31 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2S)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]pent-4-ynoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2S)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]pent-4-ynoate |
|---|---|
| PubChem CID | 59248170 |
| Molecular Formula | C16H15N3O7 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2S)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]pent-4-ynoate |
| SMILES | C#CC[C@H](NC(=O)CCN1C(=O)C=CC1=O)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C16H15N3O7/c1-2-3-10(16(25)26-19-14(23)6-7-15(19)24)17-11(20)8-9-18-12(21)4-5-13(18)22/h1,4-5,10H,3,6-9H2,(H,17,20)/t10-/m0/s1 |
| InChIKey | JNWBZUUEFJRSJC-JTQLQIEISA-N |
| XLogP | -1.58 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|