C21H32O12 — CID 59266783
[2,4-dihydroxy-6-(2-hydroxy-1-prop-2-enoyloxypropoxy)-5-(2-hydroxy-3-prop-2-enoyloxypropoxy)hexyl] prop-2-enoate (PubChem CID 59266783) has the molecular formula C21H32O12 and a molecular weight of 476.48 g/mol. Its IUPAC name is [2,4-dihydroxy-6-(2-hydroxy-1-prop-2-enoyloxypropoxy)-5-(2-hydroxy-3-prop-2-enoyloxypropoxy)hexyl] prop-2-enoate.
| Compound Name | [2,4-dihydroxy-6-(2-hydroxy-1-prop-2-enoyloxypropoxy)-5-(2-hydroxy-3-prop-2-enoyloxypropoxy)hexyl] prop-2-enoate |
|---|---|
| PubChem CID | 59266783 |
| Molecular Formula | C21H32O12 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | [2,4-dihydroxy-6-(2-hydroxy-1-prop-2-enoyloxypropoxy)-5-(2-hydroxy-3-prop-2-enoyloxypropoxy)hexyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)COC(COC(OC(=O)C=C)C(C)O)C(O)CC(O)COC(=O)C=C |
| InChI | InChI=1S/C21H32O12/c1-5-18(26)30-9-14(23)8-16(25)17(29-10-15(24)11-31-19(27)6-2)12-32-21(13(4)22)33-20(28)7-3/h5-7,13-17,21-25H,1-3,8-12H2,4H3 |
| InChIKey | ACDLRNMYPXSAFD-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|