C9H10BrClN2O2 — CID 59276950
N-(2-bromo-4-pyridinyl)-2-(2-chloroethoxy)acetamide (PubChem CID 59276950) has the molecular formula C9H10BrClN2O2 and a molecular weight of 293.55 g/mol. Its IUPAC name is N-(2-bromo-4-pyridinyl)-2-(2-chloroethoxy)acetamide.
| Compound Name | N-(2-bromo-4-pyridinyl)-2-(2-chloroethoxy)acetamide |
|---|---|
| PubChem CID | 59276950 |
| Molecular Formula | C9H10BrClN2O2 |
| Molecular Weight | 293.55 g/mol |
| Exact Mass | 291.96 |
| IUPAC Name | N-(2-bromo-4-pyridinyl)-2-(2-chloroethoxy)acetamide |
| SMILES | O=C(COCCCl)Nc1ccnc(Br)c1 |
| InChI | InChI=1S/C9H10BrClN2O2/c10-8-5-7(1-3-12-8)13-9(14)6-15-4-2-11/h1,3,5H,2,4,6H2,(H,12,13,14) |
| InChIKey | PPHJWZVSTLLEPI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.55 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|