C10H12BrClN2O4 — CID 58713604
N-[2-bromo-5-(hydroperoxyamino)phenyl]-2-(2-chloroethoxy)acetamide (PubChem CID 58713604) has the molecular formula C10H12BrClN2O4 and a molecular weight of 339.57 g/mol. Its IUPAC name is N-[2-bromo-5-(hydroperoxyamino)phenyl]-2-(2-chloroethoxy)acetamide.
| Compound Name | N-[2-bromo-5-(hydroperoxyamino)phenyl]-2-(2-chloroethoxy)acetamide |
|---|---|
| PubChem CID | 58713604 |
| Molecular Formula | C10H12BrClN2O4 |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | N-[2-bromo-5-(hydroperoxyamino)phenyl]-2-(2-chloroethoxy)acetamide |
| SMILES | O=C(COCCCl)Nc1cc(NOO)ccc1Br |
| InChI | InChI=1S/C10H12BrClN2O4/c11-8-2-1-7(14-18-16)5-9(8)13-10(15)6-17-4-3-12/h1-2,5,14,16H,3-4,6H2,(H,13,15) |
| InChIKey | VVFYLKKIJSJUJH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|