C19H14O6S-2 — CID 59286359
5-[(3-carboxylato-5-phenylfuran-2-yl)methylsulfanylmethyl]-2-methylfuran-3-carboxylate (PubChem CID 59286359) has the molecular formula C19H14O6S-2 and a molecular weight of 370.38 g/mol. Its IUPAC name is 5-[(3-carboxylato-5-phenylfuran-2-yl)methylsulfanylmethyl]-2-methylfuran-3-carboxylate.
| Compound Name | 5-[(3-carboxylato-5-phenylfuran-2-yl)methylsulfanylmethyl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 59286359 |
| Molecular Formula | C19H14O6S-2 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | 5-[(3-carboxylato-5-phenylfuran-2-yl)methylsulfanylmethyl]-2-methylfuran-3-carboxylate |
| SMILES | Cc1oc(CSCc2oc(-c3ccccc3)cc2C(=O)[O-])cc1C(=O)[O-] |
| InChI | InChI=1S/C19H16O6S/c1-11-14(18(20)21)7-13(24-11)9-26-10-17-15(19(22)23)8-16(25-17)12-5-3-2-4-6-12/h2-8H,9-10H2,1H3,(H,20,21)(H,22,23)/p-2 |
| InChIKey | IMRNXDPRGBDDDX-UHFFFAOYSA-L |
| XLogP | 2.01 |
| TPSA | 106.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |