C19H22O5 — CID 45257319
(6-methoxy-6-oxohexyl) 2-methyl-5-phenylfuran-3-carboxylate (PubChem CID 45257319) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is (6-methoxy-6-oxohexyl) 2-methyl-5-phenylfuran-3-carboxylate.
| Compound Name | (6-methoxy-6-oxohexyl) 2-methyl-5-phenylfuran-3-carboxylate |
|---|---|
| PubChem CID | 45257319 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (6-methoxy-6-oxohexyl) 2-methyl-5-phenylfuran-3-carboxylate |
| SMILES | COC(=O)CCCCCOC(=O)c1cc(-c2ccccc2)oc1C |
| InChI | InChI=1S/C19H22O5/c1-14-16(13-17(24-14)15-9-5-3-6-10-15)19(21)23-12-8-4-7-11-18(20)22-2/h3,5-6,9-10,13H,4,7-8,11-12H2,1-2H3 |
| InChIKey | YZJOPDIAJHIQBG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|