About 1-[[(1R,3S)-2,2-dimethyl-3-(phenylmethoxymethyl)cyclobutyl]methyl]-4-phenylpiperidine
1-[[(1R,3S)-2,2-dimethyl-3-(phenylmethoxymethyl)cyclobutyl]methyl]-4-phenylpiperidine (PubChem CID 59293421) has the molecular formula C26H35NO
and a molecular weight of 377.57 g/mol. Its IUPAC name is 1-[[(1R,3S)-2,2-dimethyl-3-(phenylmethoxymethyl)cyclobutyl]methyl]-4-phenylpiperidine.
Molecular Properties
| Compound Name | 1-[[(1R,3S)-2,2-dimethyl-3-(phenylmethoxymethyl)cyclobutyl]methyl]-4-phenylpiperidine |
| PubChem CID | 59293421 |
| Molecular Formula | C26H35NO |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | 1-[[(1R,3S)-2,2-dimethyl-3-(phenylmethoxymethyl)cyclobutyl]methyl]-4-phenylpiperidine |
| SMILES | CC1(C)[C@@H](COCc2ccccc2)C[C@H]1CN1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H35NO/c1-26(2)24(17-25(26)20-28-19-21-9-5-3-6-10-21)18-27-15-13-23(14-16-27)22-11-7-4-8-12-22/h3-12,23-25H,13-20H2,1-2H3/t24-,25+/m0/s1 |
| InChIKey | BMNAOMOKYNXFDS-LOSJGSFVSA-N |
| XLogP | 5.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[[(1R,3S)-2,2-dimethyl-3-(phenylmethoxymethyl)cyclobutyl]methyl]-4-phenylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(1R,3S)-2,2-dimethyl-3-(phenylmethoxymethyl)cyclobutyl]methyl]-4-phenylpiperidine?
The IUPAC name of 1-[[(1R,3S)-2,2-dimethyl-3-(phenylmethoxymethyl)cyclobutyl]methyl]-4-phenylpiperidine (CID 59293421) is 1-[[(1R,3S)-2,2-dimethyl-3-(phenylmethoxymethyl)cyclobutyl]methyl]-4-phenylpiperidine.
What is the SMILES notation for 1-[[(1R,3S)-2,2-dimethyl-3-(phenylmethoxymethyl)cyclobutyl]methyl]-4-phenylpiperidine?
The canonical SMILES for 1-[[(1R,3S)-2,2-dimethyl-3-(phenylmethoxymethyl)cyclobutyl]methyl]-4-phenylpiperidine is CC1(C)[C@@H](COCc2ccccc2)C[C@H]1CN1CCC(c2ccccc2)CC1.
What is the InChIKey of 1-[[(1R,3S)-2,2-dimethyl-3-(phenylmethoxymethyl)cyclobutyl]methyl]-4-phenylpiperidine?
The InChIKey is BMNAOMOKYNXFDS-LOSJGSFVSA-N. The full InChI is InChI=1S/C26H35NO/c1-26(2)24(17-25(26)20-28-19-21-9-5-3-6-10-21)18-27-15-13-23(14-16-27)22-11-7-4-8-12-22/h3-12,23-25H,13-20H2,1-2H3/t24-,25+/m0/s1.
What are the key properties of 1-[[(1R,3S)-2,2-dimethyl-3-(phenylmethoxymethyl)cyclobutyl]methyl]-4-phenylpiperidine?
1-[[(1R,3S)-2,2-dimethyl-3-(phenylmethoxymethyl)cyclobutyl]methyl]-4-phenylpiperidine has a molecular weight of 377.57 g/mol, XLogP of 5.75, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(1R,3S)-2,2-dimethyl-3-(phenylmethoxymethyl)cyclobutyl]methyl]-4-phenylpiperidine is sourced from PubChem (CID 59293421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).