C18H30O7S2 — CID 87509607
2-[(1R,3R)-2,2-dimethyl-3-(phenylmethoxymethyl)cyclobutyl]ethyl methanesulfonate;methanesulfonic acid (PubChem CID 87509607) has the molecular formula C18H30O7S2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 2-[(1R,3R)-2,2-dimethyl-3-(phenylmethoxymethyl)cyclobutyl]ethyl methanesulfonate;methanesulfonic acid.
| Compound Name | 2-[(1R,3R)-2,2-dimethyl-3-(phenylmethoxymethyl)cyclobutyl]ethyl methanesulfonate;methanesulfonic acid |
|---|---|
| PubChem CID | 87509607 |
| Molecular Formula | C18H30O7S2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 2-[(1R,3R)-2,2-dimethyl-3-(phenylmethoxymethyl)cyclobutyl]ethyl methanesulfonate;methanesulfonic acid |
| SMILES | CC1(C)[C@H](COCc2ccccc2)C[C@@H]1CCOS(C)(=O)=O.CS(=O)(=O)O |
| InChI | InChI=1S/C17H26O4S.CH4O3S/c1-17(2)15(9-10-21-22(3,18)19)11-16(17)13-20-12-14-7-5-4-6-8-14;1-5(2,3)4/h4-8,15-16H,9-13H2,1-3H3;1H3,(H,2,3,4)/t15-,16-;/m0./s1 |
| InChIKey | UCARCAZXIWMANY-MOGJOVFKSA-N |
| XLogP | 2.74 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|