C35H26F4IrN4O-2 — CID 59294212
bis(2-(2,4-difluorobenzene-6-id-1-yl)pyridine);iridium;4-[2-(2H-pyrrol-2-ylmethylideneamino)ethyl]phenol (PubChem CID 59294212) has the molecular formula C35H26F4IrN4O-2 and a molecular weight of 786.83 g/mol. Its IUPAC name is bis(2-(2,4-difluorobenzene-6-id-1-yl)pyridine);iridium;4-[2-(2H-pyrrol-2-ylmethylideneamino)ethyl]phenol.
| Compound Name | bis(2-(2,4-difluorobenzene-6-id-1-yl)pyridine);iridium;4-[2-(2H-pyrrol-2-ylmethylideneamino)ethyl]phenol |
|---|---|
| PubChem CID | 59294212 |
| Molecular Formula | C35H26F4IrN4O-2 |
| Molecular Weight | 786.83 g/mol |
| Exact Mass | 787.17 |
| IUPAC Name | bis(2-(2,4-difluorobenzene-6-id-1-yl)pyridine);iridium;4-[2-(2H-pyrrol-2-ylmethylideneamino)ethyl]phenol |
| SMILES | Fc1c[c-]c(-c2ccccn2)c(F)c1.Fc1c[c-]c(-c2ccccn2)c(F)c1.Oc1ccc(CC/N=C/C2C=CC=N2)cc1.[Ir] |
| InChI | InChI=1S/C13H14N2O.2C11H6F2N.Ir/c16-13-5-3-11(4-6-13)7-9-14-10-12-2-1-8-15-12;2*12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11;/h1-6,8,10,12,16H,7,9H2;2*1-4,6-7H;/q;2*-1;/b14-10+;;; |
| InChIKey | HUHAPTMIEHLNJN-DYVFDRNCSA-N |
| XLogP | 7.67 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.83 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|