About methoxycarbonylazanide;yttrium
methoxycarbonylazanide;yttrium (PubChem CID 59294691) has the molecular formula C2H4NO2Y-
and a molecular weight of 162.97 g/mol. Its IUPAC name is methoxycarbonylazanide;yttrium.
Molecular Properties
| Compound Name | methoxycarbonylazanide;yttrium |
| PubChem CID | 59294691 |
| Molecular Formula | C2H4NO2Y- |
| Molecular Weight | 162.97 g/mol |
| Exact Mass | 162.93 |
| IUPAC Name | methoxycarbonylazanide;yttrium |
| SMILES | COC([NH-])=O.[Y] |
| InChI | InChI=1S/C2H5NO2.Y/c1-5-2(3)4;/h1H3,(H2,3,4);/p-1 |
| InChIKey | PTUXTBLIRZVNAL-UHFFFAOYSA-M |
| XLogP | 0.80 |
| TPSA | 50.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.97 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methoxycarbonylazanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxycarbonylazanide;yttrium?
The IUPAC name of methoxycarbonylazanide;yttrium (CID 59294691) is methoxycarbonylazanide;yttrium.
What is the SMILES notation for methoxycarbonylazanide;yttrium?
The canonical SMILES for methoxycarbonylazanide;yttrium is COC([NH-])=O.[Y].
What is the InChIKey of methoxycarbonylazanide;yttrium?
The InChIKey is PTUXTBLIRZVNAL-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H5NO2.Y/c1-5-2(3)4;/h1H3,(H2,3,4);/p-1.
What are the key properties of methoxycarbonylazanide;yttrium?
methoxycarbonylazanide;yttrium has a molecular weight of 162.97 g/mol, XLogP of 0.80, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methoxycarbonylazanide;yttrium is sourced from PubChem (CID 59294691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).