About methylcarbamoylazanide;yttrium
methylcarbamoylazanide;yttrium (PubChem CID 59294756) has the molecular formula C4H10N4O2Y-2
and a molecular weight of 235.06 g/mol. Its IUPAC name is methylcarbamoylazanide;yttrium.
Molecular Properties
| Compound Name | methylcarbamoylazanide;yttrium |
| PubChem CID | 59294756 |
| Molecular Formula | C4H10N4O2Y-2 |
| Molecular Weight | 235.06 g/mol |
| Exact Mass | 234.99 |
| IUPAC Name | methylcarbamoylazanide;yttrium |
| SMILES | CNC([NH-])=O.CNC([NH-])=O.[Y] |
| InChI | InChI=1S/2C2H6N2O.Y/c2*1-4-2(3)5;/h2*1H3,(H3,3,4,5);/p-2 |
| InChIKey | FAUADOIAYGJYMR-UHFFFAOYSA-L |
| XLogP | 0.75 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.06 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methylcarbamoylazanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylcarbamoylazanide;yttrium?
The IUPAC name of methylcarbamoylazanide;yttrium (CID 59294756) is methylcarbamoylazanide;yttrium.
What is the SMILES notation for methylcarbamoylazanide;yttrium?
The canonical SMILES for methylcarbamoylazanide;yttrium is CNC([NH-])=O.CNC([NH-])=O.[Y].
What is the InChIKey of methylcarbamoylazanide;yttrium?
The InChIKey is FAUADOIAYGJYMR-UHFFFAOYSA-L. The full InChI is InChI=1S/2C2H6N2O.Y/c2*1-4-2(3)5;/h2*1H3,(H3,3,4,5);/p-2.
What are the key properties of methylcarbamoylazanide;yttrium?
methylcarbamoylazanide;yttrium has a molecular weight of 235.06 g/mol, XLogP of 0.75, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methylcarbamoylazanide;yttrium is sourced from PubChem (CID 59294756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).