About azanidylcarbonylcarbamoylazanide;copper
azanidylcarbonylcarbamoylazanide;copper (PubChem CID 138963063) has the molecular formula C4H6CuN6O4-4
and a molecular weight of 265.68 g/mol. Its IUPAC name is azanidylcarbonylcarbamoylazanide;copper.
Molecular Properties
| Compound Name | azanidylcarbonylcarbamoylazanide;copper |
| PubChem CID | 138963063 |
| Molecular Formula | C4H6CuN6O4-4 |
| Molecular Weight | 265.68 g/mol |
| Exact Mass | 264.98 |
| IUPAC Name | azanidylcarbonylcarbamoylazanide;copper |
| SMILES | [Cu].[NH-]C(=O)NC([NH-])=O.[NH-]C(=O)NC([NH-])=O |
| InChI | InChI=1S/2C2H5N3O2.Cu/c2*3-1(6)5-2(4)7;/h2*(H5,3,4,5,6,7);/p-4 |
| InChIKey | RRBDCOYGOLMHFC-UHFFFAOYSA-J |
| XLogP | 1.84 |
| TPSA | 187.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.68 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azanidylcarbonylcarbamoylazanide;copper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanidylcarbonylcarbamoylazanide;copper?
The IUPAC name of azanidylcarbonylcarbamoylazanide;copper (CID 138963063) is azanidylcarbonylcarbamoylazanide;copper.
What is the SMILES notation for azanidylcarbonylcarbamoylazanide;copper?
The canonical SMILES for azanidylcarbonylcarbamoylazanide;copper is [Cu].[NH-]C(=O)NC([NH-])=O.[NH-]C(=O)NC([NH-])=O.
What is the InChIKey of azanidylcarbonylcarbamoylazanide;copper?
The InChIKey is RRBDCOYGOLMHFC-UHFFFAOYSA-J. The full InChI is InChI=1S/2C2H5N3O2.Cu/c2*3-1(6)5-2(4)7;/h2*(H5,3,4,5,6,7);/p-4.
What are the key properties of azanidylcarbonylcarbamoylazanide;copper?
azanidylcarbonylcarbamoylazanide;copper has a molecular weight of 265.68 g/mol, XLogP of 1.84, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanidylcarbonylcarbamoylazanide;copper is sourced from PubChem (CID 138963063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).