C9H3F13O4 — CID 59297117
4-[difluoro(1,1,2,2-tetrafluoropropoxy)methyl]-4,5,5-trifluoro-2-(trifluoromethyl)-1,3-dioxolane-2-carbonyl fluoride (PubChem CID 59297117) has the molecular formula C9H3F13O4 and a molecular weight of 422.09 g/mol. Its IUPAC name is 4-[difluoro(1,1,2,2-tetrafluoropropoxy)methyl]-4,5,5-trifluoro-2-(trifluoromethyl)-1,3-dioxolane-2-carbonyl fluoride.
| Compound Name | 4-[difluoro(1,1,2,2-tetrafluoropropoxy)methyl]-4,5,5-trifluoro-2-(trifluoromethyl)-1,3-dioxolane-2-carbonyl fluoride |
|---|---|
| PubChem CID | 59297117 |
| Molecular Formula | C9H3F13O4 |
| Molecular Weight | 422.09 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | 4-[difluoro(1,1,2,2-tetrafluoropropoxy)methyl]-4,5,5-trifluoro-2-(trifluoromethyl)-1,3-dioxolane-2-carbonyl fluoride |
| SMILES | CC(F)(F)C(F)(F)OC(F)(F)C1(F)OC(C(=O)F)(C(F)(F)F)OC1(F)F |
| InChI | InChI=1S/C9H3F13O4/c1-3(11,12)7(17,18)26-9(21,22)5(13)8(19,20)25-4(24-5,2(10)23)6(14,15)16/h1H3 |
| InChIKey | OBIKGKSWYYDAFD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.09 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|