C6F8O4 — CID 98047390
(2R,4R)-4-fluoro-5-oxo-2,4-bis(trifluoromethyl)-1,3-dioxolane-2-carbonyl fluoride (PubChem CID 98047390) has the molecular formula C6F8O4 and a molecular weight of 288.05 g/mol. Its IUPAC name is (2R,4R)-4-fluoro-5-oxo-2,4-bis(trifluoromethyl)-1,3-dioxolane-2-carbonyl fluoride.
| Compound Name | (2R,4R)-4-fluoro-5-oxo-2,4-bis(trifluoromethyl)-1,3-dioxolane-2-carbonyl fluoride |
|---|---|
| PubChem CID | 98047390 |
| Molecular Formula | C6F8O4 |
| Molecular Weight | 288.05 g/mol |
| Exact Mass | 287.97 |
| IUPAC Name | (2R,4R)-4-fluoro-5-oxo-2,4-bis(trifluoromethyl)-1,3-dioxolane-2-carbonyl fluoride |
| SMILES | O=C(F)[C@@]1(C(F)(F)F)OC(=O)[C@@](F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C6F8O4/c7-1(15)4(6(12,13)14)17-2(16)3(8,18-4)5(9,10)11/t3-,4+/m0/s1 |
| InChIKey | NVLMRLQANVCTOG-IUYQGCFVSA-N |
| XLogP | 1.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.05 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|