C26H33N5OS — CID 59322584
(E)-4-(diethylamino)-1-[3-[[(1R)-1-phenylpropyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one (PubChem CID 59322584) has the molecular formula C26H33N5OS and a molecular weight of 463.65 g/mol. Its IUPAC name is (E)-4-(diethylamino)-1-[3-[[(1R)-1-phenylpropyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one.
| Compound Name | (E)-4-(diethylamino)-1-[3-[[(1R)-1-phenylpropyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 59322584 |
| Molecular Formula | C26H33N5OS |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | (E)-4-(diethylamino)-1-[3-[[(1R)-1-phenylpropyl]amino]-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
| SMILES | CC[C@@H](Nc1ncnc2sc3c(c12)CCN(C(=O)/C=C/CN(CC)CC)C3)c1ccccc1 |
| InChI | InChI=1S/C26H33N5OS/c1-4-21(19-11-8-7-9-12-19)29-25-24-20-14-16-31(17-22(20)33-26(24)28-18-27-25)23(32)13-10-15-30(5-2)6-3/h7-13,18,21H,4-6,14-17H2,1-3H3,(H,27,28,29)/b13-10+/t21-/m1/s1 |
| InChIKey | BUDVWJPQXJVRDH-QYFOZDBKSA-N |
| XLogP | 5.04 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|