C25H31N5O2S — CID 91069407
4-(dimethylamino)-1-[3-[[(1S)-2-hydroxy-1-phenylethyl]amino]-12,12-dimethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one (PubChem CID 91069407) has the molecular formula C25H31N5O2S and a molecular weight of 465.62 g/mol. Its IUPAC name is 4-(dimethylamino)-1-[3-[[(1S)-2-hydroxy-1-phenylethyl]amino]-12,12-dimethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one.
| Compound Name | 4-(dimethylamino)-1-[3-[[(1S)-2-hydroxy-1-phenylethyl]amino]-12,12-dimethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 91069407 |
| Molecular Formula | C25H31N5O2S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 4-(dimethylamino)-1-[3-[[(1S)-2-hydroxy-1-phenylethyl]amino]-12,12-dimethyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraen-11-yl]but-2-en-1-one |
| SMILES | CN(C)CC=CC(=O)N1Cc2sc3ncnc(N[C@H](CO)c4ccccc4)c3c2CC1(C)C |
| InChI | InChI=1S/C25H31N5O2S/c1-25(2)13-18-20(14-30(25)21(32)11-8-12-29(3)4)33-24-22(18)23(26-16-27-24)28-19(15-31)17-9-6-5-7-10-17/h5-11,16,19,31H,12-15H2,1-4H3,(H,26,27,28)/t19-/m1/s1 |
| InChIKey | RKGGPGJSMLVBEB-LJQANCHMSA-N |
| XLogP | 3.62 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|