C25H28N6O4S — CID 59322662
methyl (2S)-2-[[4-[(E)-4-[2-(dimethylamino)ethylamino]-4-oxobut-2-enoyl]-7-thia-4,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]amino]-2-phenylacetate (PubChem CID 59322662) has the molecular formula C25H28N6O4S and a molecular weight of 508.60 g/mol. Its IUPAC name is methyl (2S)-2-[[4-[(E)-4-[2-(dimethylamino)ethylamino]-4-oxobut-2-enoyl]-7-thia-4,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]amino]-2-phenylacetate.
| Compound Name | methyl (2S)-2-[[4-[(E)-4-[2-(dimethylamino)ethylamino]-4-oxobut-2-enoyl]-7-thia-4,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 59322662 |
| Molecular Formula | C25H28N6O4S |
| Molecular Weight | 508.60 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | methyl (2S)-2-[[4-[(E)-4-[2-(dimethylamino)ethylamino]-4-oxobut-2-enoyl]-7-thia-4,9,11-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl]amino]-2-phenylacetate |
| SMILES | COC(=O)[C@@H](Nc1ncnc2sc3c(c12)CN(C(=O)/C=C/C(=O)NCCN(C)C)C3)c1ccccc1 |
| InChI | InChI=1S/C25H28N6O4S/c1-30(2)12-11-26-19(32)9-10-20(33)31-13-17-18(14-31)36-24-21(17)23(27-15-28-24)29-22(25(34)35-3)16-7-5-4-6-8-16/h4-10,15,22H,11-14H2,1-3H3,(H,26,32)(H,27,28,29)/b10-9+/t22-/m0/s1 |
| InChIKey | UWSHLIIYFCVDKQ-CZQLGGELSA-N |
| XLogP | 2.09 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.60 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|