C35H40N4O3 — CID 59324974
2-[3-[(2R)-2,4-dibenzylpiperazine-1-carbonyl]-2-phenylpyrrol-1-yl]-N-(4-hydroxybutyl)acetamide (PubChem CID 59324974) has the molecular formula C35H40N4O3 and a molecular weight of 564.73 g/mol. Its IUPAC name is 2-[3-[(2R)-2,4-dibenzylpiperazine-1-carbonyl]-2-phenylpyrrol-1-yl]-N-(4-hydroxybutyl)acetamide.
| Compound Name | 2-[3-[(2R)-2,4-dibenzylpiperazine-1-carbonyl]-2-phenylpyrrol-1-yl]-N-(4-hydroxybutyl)acetamide |
|---|---|
| PubChem CID | 59324974 |
| Molecular Formula | C35H40N4O3 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.31 |
| IUPAC Name | 2-[3-[(2R)-2,4-dibenzylpiperazine-1-carbonyl]-2-phenylpyrrol-1-yl]-N-(4-hydroxybutyl)acetamide |
| SMILES | O=C(Cn1ccc(C(=O)N2CCN(Cc3ccccc3)C[C@H]2Cc2ccccc2)c1-c1ccccc1)NCCCCO |
| InChI | InChI=1S/C35H40N4O3/c40-23-11-10-19-36-33(41)27-38-20-18-32(34(38)30-16-8-3-9-17-30)35(42)39-22-21-37(25-29-14-6-2-7-15-29)26-31(39)24-28-12-4-1-5-13-28/h1-9,12-18,20,31,40H,10-11,19,21-27H2,(H,36,41)/t31-/m1/s1 |
| InChIKey | FUOPPTXCJDLDSV-WJOKGBTCSA-N |
| XLogP | 4.61 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|