C23H27NO5S — CID 59331326
5-(4-methylsulfonylphenyl)-6-(oxan-4-yl)-1-pyridin-2-ylhexane-1,4-dione (PubChem CID 59331326) has the molecular formula C23H27NO5S and a molecular weight of 429.54 g/mol. Its IUPAC name is 5-(4-methylsulfonylphenyl)-6-(oxan-4-yl)-1-pyridin-2-ylhexane-1,4-dione.
| Compound Name | 5-(4-methylsulfonylphenyl)-6-(oxan-4-yl)-1-pyridin-2-ylhexane-1,4-dione |
|---|---|
| PubChem CID | 59331326 |
| Molecular Formula | C23H27NO5S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 5-(4-methylsulfonylphenyl)-6-(oxan-4-yl)-1-pyridin-2-ylhexane-1,4-dione |
| SMILES | CS(=O)(=O)c1ccc(C(CC2CCOCC2)C(=O)CCC(=O)c2ccccn2)cc1 |
| InChI | InChI=1S/C23H27NO5S/c1-30(27,28)19-7-5-18(6-8-19)20(16-17-11-14-29-15-12-17)22(25)9-10-23(26)21-4-2-3-13-24-21/h2-8,13,17,20H,9-12,14-16H2,1H3 |
| InChIKey | OPOZULIRIOVNKY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |