About azetidin-1-ylmethanone;ethane;tungsten(2+)
azetidin-1-ylmethanone;ethane;tungsten(2+) (PubChem CID 59337253) has the molecular formula C6H11NOW
and a molecular weight of 297.00 g/mol. Its IUPAC name is azetidin-1-ylmethanone;ethane;tungsten(2+).
Molecular Properties
| Compound Name | azetidin-1-ylmethanone;ethane;tungsten(2+) |
| PubChem CID | 59337253 |
| Molecular Formula | C6H11NOW |
| Molecular Weight | 297.00 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | azetidin-1-ylmethanone;ethane;tungsten(2+) |
| SMILES | O=[C-]N1CCC1.[CH2-]C.[W+2] |
| InChI | InChI=1S/C4H6NO.C2H5.W/c6-4-5-2-1-3-5;1-2;/h1-3H2;1H2,2H3;/q2*-1;+2 |
| InChIKey | FDZRLNZOVKBTEQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.00 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze azetidin-1-ylmethanone;ethane;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-1-ylmethanone;ethane;tungsten(2+)?
The IUPAC name of azetidin-1-ylmethanone;ethane;tungsten(2+) (CID 59337253) is azetidin-1-ylmethanone;ethane;tungsten(2+).
What is the SMILES notation for azetidin-1-ylmethanone;ethane;tungsten(2+)?
The canonical SMILES for azetidin-1-ylmethanone;ethane;tungsten(2+) is O=[C-]N1CCC1.[CH2-]C.[W+2].
What is the InChIKey of azetidin-1-ylmethanone;ethane;tungsten(2+)?
The InChIKey is FDZRLNZOVKBTEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6NO.C2H5.W/c6-4-5-2-1-3-5;1-2;/h1-3H2;1H2,2H3;/q2*-1;+2.
What are the key properties of azetidin-1-ylmethanone;ethane;tungsten(2+)?
azetidin-1-ylmethanone;ethane;tungsten(2+) has a molecular weight of 297.00 g/mol, XLogP of 0.60, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-1-ylmethanone;ethane;tungsten(2+) is sourced from PubChem (CID 59337253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).