C8H12OS5 — CID 59341518
S-[(3R,5R,8S)-8-methyl-1,4,6,9-tetrathiaspiro[4.4]nonan-3-yl] ethanethioate (PubChem CID 59341518) has the molecular formula C8H12OS5 and a molecular weight of 284.52 g/mol. Its IUPAC name is S-[(3R,5R,8S)-8-methyl-1,4,6,9-tetrathiaspiro[4.4]nonan-3-yl] ethanethioate.
| Compound Name | S-[(3R,5R,8S)-8-methyl-1,4,6,9-tetrathiaspiro[4.4]nonan-3-yl] ethanethioate |
|---|---|
| PubChem CID | 59341518 |
| Molecular Formula | C8H12OS5 |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 283.95 |
| IUPAC Name | S-[(3R,5R,8S)-8-methyl-1,4,6,9-tetrathiaspiro[4.4]nonan-3-yl] ethanethioate |
| SMILES | CC(=O)S[C@H]1CS[C@@]2(SC[C@H](C)S2)S1 |
| InChI | InChI=1S/C8H12OS5/c1-5-3-10-8(13-5)11-4-7(14-8)12-6(2)9/h5,7H,3-4H2,1-2H3/t5-,7+,8+/m0/s1 |
| InChIKey | ZCMJCAWAXKVHJS-UIISKDMLSA-N |
| XLogP | 3.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|