C31H18N2O6S — CID 59344047
7-methyl-17-[4-(4-methylphenoxy)phenyl]-2-thia-7,17-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,12,16,18-pentone (PubChem CID 59344047) has the molecular formula C31H18N2O6S and a molecular weight of 546.56 g/mol. Its IUPAC name is 7-methyl-17-[4-(4-methylphenoxy)phenyl]-2-thia-7,17-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,12,16,18-pentone.
| Compound Name | 7-methyl-17-[4-(4-methylphenoxy)phenyl]-2-thia-7,17-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,12,16,18-pentone |
|---|---|
| PubChem CID | 59344047 |
| Molecular Formula | C31H18N2O6S |
| Molecular Weight | 546.56 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | 7-methyl-17-[4-(4-methylphenoxy)phenyl]-2-thia-7,17-diazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3(11),4,9,14,19-hexaene-6,8,12,16,18-pentone |
| SMILES | Cc1ccc(Oc2ccc(-n3c(=O)c4cc5sc6cc7c(=O)n(C)c(=O)c7cc6c(=O)c5cc4c3=O)cc2)cc1 |
| InChI | InChI=1S/C31H18N2O6S/c1-15-3-7-17(8-4-15)39-18-9-5-16(6-10-18)33-30(37)20-12-24-26(14-22(20)31(33)38)40-25-13-21-19(11-23(25)27(24)34)28(35)32(2)29(21)36/h3-14H,1-2H3 |
| InChIKey | CJQMVZSVCAUSGE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 104.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.56 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|