C30H21N9 — CID 59344228
2-phenyl-1,1,3,3-tetra(pyrimidin-2-yl)isoindole (PubChem CID 59344228) has the molecular formula C30H21N9 and a molecular weight of 507.56 g/mol. Its IUPAC name is 2-phenyl-1,1,3,3-tetra(pyrimidin-2-yl)isoindole.
| Compound Name | 2-phenyl-1,1,3,3-tetra(pyrimidin-2-yl)isoindole |
|---|---|
| PubChem CID | 59344228 |
| Molecular Formula | C30H21N9 |
| Molecular Weight | 507.56 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 2-phenyl-1,1,3,3-tetra(pyrimidin-2-yl)isoindole |
| SMILES | c1ccc(N2C(c3ncccn3)(c3ncccn3)c3ccccc3C2(c2ncccn2)c2ncccn2)cc1 |
| InChI | InChI=1S/C30H21N9/c1-2-10-22(11-3-1)39-29(25-31-14-6-15-32-25,26-33-16-7-17-34-26)23-12-4-5-13-24(23)30(39,27-35-18-8-19-36-27)28-37-20-9-21-38-28/h1-21H |
| InChIKey | VIVFOTHMVCMWON-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |