C18H27NO7S — CID 59349905
[8-(C-methylsulfonylcarbonimidoyl)oxy-5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-1-yl] 2,2-dimethylbutanoate (PubChem CID 59349905) has the molecular formula C18H27NO7S and a molecular weight of 401.48 g/mol. Its IUPAC name is [8-(C-methylsulfonylcarbonimidoyl)oxy-5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [8-(C-methylsulfonylcarbonimidoyl)oxy-5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 59349905 |
| Molecular Formula | C18H27NO7S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | [8-(C-methylsulfonylcarbonimidoyl)oxy-5-oxo-4-oxatricyclo[4.3.1.13,8]undecan-1-yl] 2,2-dimethylbutanoate |
| SMILES | [H]/N=C(/OC12CC3CC(OC(=O)C(C)(C)CC)(CC(C1)C(=O)O3)C2)S(C)(=O)=O |
| InChI | InChI=1S/C18H27NO7S/c1-5-16(2,3)14(21)25-17-6-11-7-18(10-17,26-15(19)27(4,22)23)9-12(8-17)24-13(11)20/h11-12,19H,5-10H2,1-4H3/b19-15- |
| InChIKey | MCULDFTYRGIQTI-CYVLTUHYSA-N |
| XLogP | 1.96 |
| TPSA | 119.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|