C22H37NO3 — CID 59351041
(1R,3aR,7aR)-1-[(2S)-1-[(2Z)-3,3-dimethyl-2-prop-2-enoxyiminobutoxy]propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one (PubChem CID 59351041) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is (1R,3aR,7aR)-1-[(2S)-1-[(2Z)-3,3-dimethyl-2-prop-2-enoxyiminobutoxy]propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one.
| Compound Name | (1R,3aR,7aR)-1-[(2S)-1-[(2Z)-3,3-dimethyl-2-prop-2-enoxyiminobutoxy]propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
|---|---|
| PubChem CID | 59351041 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | (1R,3aR,7aR)-1-[(2S)-1-[(2Z)-3,3-dimethyl-2-prop-2-enoxyiminobutoxy]propan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one |
| SMILES | C=CCO/N=C(\COC[C@@H](C)[C@H]1CC[C@H]2C(=O)CCC[C@]12C)C(C)(C)C |
| InChI | InChI=1S/C22H37NO3/c1-7-13-26-23-20(21(3,4)5)15-25-14-16(2)17-10-11-18-19(24)9-8-12-22(17,18)6/h7,16-18H,1,8-15H2,2-6H3/b23-20+/t16-,17-,18+,22-/m1/s1 |
| InChIKey | SYWMEESTQDUXHW-ZHEMBESMSA-N |
| XLogP | 5.03 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|