C8H15ClN2O — CID 59366474
2-chloro-N'-(5-oxohexyl)ethanimidamide (PubChem CID 59366474) has the molecular formula C8H15ClN2O and a molecular weight of 190.67 g/mol. Its IUPAC name is 2-chloro-N'-(5-oxohexyl)ethanimidamide.
| Compound Name | 2-chloro-N'-(5-oxohexyl)ethanimidamide |
|---|---|
| PubChem CID | 59366474 |
| Molecular Formula | C8H15ClN2O |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 2-chloro-N'-(5-oxohexyl)ethanimidamide |
| SMILES | CC(=O)CCCC/N=C(/N)CCl |
| InChI | InChI=1S/C8H15ClN2O/c1-7(12)4-2-3-5-11-8(10)6-9/h2-6H2,1H3,(H2,10,11) |
| InChIKey | XKVMNPRKWANIND-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|