C19H24N4O5S — CID 59369731
methyl 6-[[2-[2-(pyridin-3-ylmethoxycarbonylamino)-1,3-thiazol-4-yl]acetyl]amino]hexanoate (PubChem CID 59369731) has the molecular formula C19H24N4O5S and a molecular weight of 420.49 g/mol. Its IUPAC name is methyl 6-[[2-[2-(pyridin-3-ylmethoxycarbonylamino)-1,3-thiazol-4-yl]acetyl]amino]hexanoate.
| Compound Name | methyl 6-[[2-[2-(pyridin-3-ylmethoxycarbonylamino)-1,3-thiazol-4-yl]acetyl]amino]hexanoate |
|---|---|
| PubChem CID | 59369731 |
| Molecular Formula | C19H24N4O5S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | methyl 6-[[2-[2-(pyridin-3-ylmethoxycarbonylamino)-1,3-thiazol-4-yl]acetyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)Cc1csc(NC(=O)OCc2cccnc2)n1 |
| InChI | InChI=1S/C19H24N4O5S/c1-27-17(25)7-3-2-4-9-21-16(24)10-15-13-29-18(22-15)23-19(26)28-12-14-6-5-8-20-11-14/h5-6,8,11,13H,2-4,7,9-10,12H2,1H3,(H,21,24)(H,22,23,26) |
| InChIKey | VUXPSDDIDGMUTP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|