C25H26N7+ — CID 59376924
7-[3-(aminomethyl)cyclobutyl]-5-(2-benzyl-1H-indazol-2-ium-6-yl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 59376924) has the molecular formula C25H26N7+ and a molecular weight of 424.53 g/mol. Its IUPAC name is 7-[3-(aminomethyl)cyclobutyl]-5-(2-benzyl-1H-indazol-2-ium-6-yl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 7-[3-(aminomethyl)cyclobutyl]-5-(2-benzyl-1H-indazol-2-ium-6-yl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 59376924 |
| Molecular Formula | C25H26N7+ |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 7-[3-(aminomethyl)cyclobutyl]-5-(2-benzyl-1H-indazol-2-ium-6-yl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | NCC1CC(n2cc(-c3ccc4c[n+](Cc5ccccc5)[nH]c4c3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C25H25N7/c26-11-17-8-20(9-17)32-14-21(23-24(27)28-15-29-25(23)32)18-6-7-19-13-31(30-22(19)10-18)12-16-4-2-1-3-5-16/h1-7,10,13-15,17,20H,8-9,11-12,26H2,(H2,27,28,29)/p+1 |
| InChIKey | XBZZZQHTUAUKDC-UHFFFAOYSA-O |
| XLogP | 3.41 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|