C30H38N4O5 — CID 59379852
ethyl N-[3-tert-butyl-N-[[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]carbamoyl]anilino]carbamate (PubChem CID 59379852) has the molecular formula C30H38N4O5 and a molecular weight of 534.66 g/mol. Its IUPAC name is ethyl N-[3-tert-butyl-N-[[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]carbamoyl]anilino]carbamate.
| Compound Name | ethyl N-[3-tert-butyl-N-[[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]carbamoyl]anilino]carbamate |
|---|---|
| PubChem CID | 59379852 |
| Molecular Formula | C30H38N4O5 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | ethyl N-[3-tert-butyl-N-[[4-(2-morpholin-4-ylethoxy)naphthalen-1-yl]carbamoyl]anilino]carbamate |
| SMILES | CCOC(=O)NN(C(=O)Nc1ccc(OCCN2CCOCC2)c2ccccc12)c1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H38N4O5/c1-5-38-29(36)32-34(23-10-8-9-22(21-23)30(2,3)4)28(35)31-26-13-14-27(25-12-7-6-11-24(25)26)39-20-17-33-15-18-37-19-16-33/h6-14,21H,5,15-20H2,1-4H3,(H,31,35)(H,32,36) |
| InChIKey | GSQQDKXBALAKFU-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|