C22H36ClNO4SSi — CID 59389225
tert-butyl-[1-[(3R,5R)-4-(4-chlorophenyl)sulfonyl-5-propylmorpholin-3-yl]cyclopropyl]oxy-dimethylsilane (PubChem CID 59389225) has the molecular formula C22H36ClNO4SSi and a molecular weight of 474.14 g/mol. Its IUPAC name is tert-butyl-[1-[(3R,5R)-4-(4-chlorophenyl)sulfonyl-5-propylmorpholin-3-yl]cyclopropyl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[1-[(3R,5R)-4-(4-chlorophenyl)sulfonyl-5-propylmorpholin-3-yl]cyclopropyl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 59389225 |
| Molecular Formula | C22H36ClNO4SSi |
| Molecular Weight | 474.14 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | tert-butyl-[1-[(3R,5R)-4-(4-chlorophenyl)sulfonyl-5-propylmorpholin-3-yl]cyclopropyl]oxy-dimethylsilane |
| SMILES | CCC[C@@H]1COC[C@H](C2(O[Si](C)(C)C(C)(C)C)CC2)N1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H36ClNO4SSi/c1-7-8-18-15-27-16-20(22(13-14-22)28-30(5,6)21(2,3)4)24(18)29(25,26)19-11-9-17(23)10-12-19/h9-12,18,20H,7-8,13-16H2,1-6H3/t18-,20-/m1/s1 |
| InChIKey | RTYOSXHLACUMLY-UYAOXDASSA-N |
| XLogP | 5.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.14 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|