C36H38Cl3N3O9 — CID 59391915
4-nitrooxybutyl 4-[4-[2-(4-chloro-2-methoxyphenoxy)ethoxy]phenyl]-5-[cyclopropyl-[(2,3-dichlorophenyl)methyl]carbamoyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 59391915) has the molecular formula C36H38Cl3N3O9 and a molecular weight of 763.07 g/mol. Its IUPAC name is 4-nitrooxybutyl 4-[4-[2-(4-chloro-2-methoxyphenoxy)ethoxy]phenyl]-5-[cyclopropyl-[(2,3-dichlorophenyl)methyl]carbamoyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | 4-nitrooxybutyl 4-[4-[2-(4-chloro-2-methoxyphenoxy)ethoxy]phenyl]-5-[cyclopropyl-[(2,3-dichlorophenyl)methyl]carbamoyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 59391915 |
| Molecular Formula | C36H38Cl3N3O9 |
| Molecular Weight | 763.07 g/mol |
| Exact Mass | 761.17 |
| IUPAC Name | 4-nitrooxybutyl 4-[4-[2-(4-chloro-2-methoxyphenoxy)ethoxy]phenyl]-5-[cyclopropyl-[(2,3-dichlorophenyl)methyl]carbamoyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COc1cc(Cl)ccc1OCCOc1ccc(C2=C(C(=O)N(Cc3cccc(Cl)c3Cl)C3CC3)CN(C(=O)OCCCCO[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C36H38Cl3N3O9/c1-47-33-21-26(37)9-14-32(33)49-20-19-48-28-12-7-24(8-13-28)29-15-16-40(36(44)50-17-2-3-18-51-42(45)46)23-30(29)35(43)41(27-10-11-27)22-25-5-4-6-31(38)34(25)39/h4-9,12-14,21,27H,2-3,10-11,15-20,22-23H2,1H3 |
| InChIKey | TVRKPYIUQUPXFH-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 129.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.07 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|