C38H38Cl2F3N3O8 — CID 59391887
4-nitrooxybutyl 2-[cyclopropyl-[(2,3-dichlorophenyl)methyl]carbamoyl]-3-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenoxy]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 59391887) has the molecular formula C38H38Cl2F3N3O8 and a molecular weight of 792.63 g/mol. Its IUPAC name is 4-nitrooxybutyl 2-[cyclopropyl-[(2,3-dichlorophenyl)methyl]carbamoyl]-3-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenoxy]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | 4-nitrooxybutyl 2-[cyclopropyl-[(2,3-dichlorophenyl)methyl]carbamoyl]-3-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenoxy]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 59391887 |
| Molecular Formula | C38H38Cl2F3N3O8 |
| Molecular Weight | 792.63 g/mol |
| Exact Mass | 791.20 |
| IUPAC Name | 4-nitrooxybutyl 2-[cyclopropyl-[(2,3-dichlorophenyl)methyl]carbamoyl]-3-[4-[3-(2,3,6-trifluorophenoxy)propyl]phenoxy]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | O=C(C1=C(Oc2ccc(CCCOc3c(F)ccc(F)c3F)cc2)CC2CCC1N2C(=O)OCCCCO[N+](=O)[O-])N(Cc1cccc(Cl)c1Cl)C1CC1 |
| InChI | InChI=1S/C38H38Cl2F3N3O8/c39-28-7-3-6-24(34(28)40)22-44(25-10-11-25)37(47)33-31-17-12-26(45(31)38(48)52-18-1-2-20-53-46(49)50)21-32(33)54-27-13-8-23(9-14-27)5-4-19-51-36-30(42)16-15-29(41)35(36)43/h3,6-9,13-16,25-26,31H,1-2,4-5,10-12,17-22H2 |
| InChIKey | VAXIECJAIBJCCD-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 120.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.63 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|