C17H26N2O5 — CID 59392275
(2,5-dioxopyrrolidin-1-yl) 6-(2,6-dimethylpiperidin-1-yl)-5-oxohexanoate (PubChem CID 59392275) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-(2,6-dimethylpiperidin-1-yl)-5-oxohexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-(2,6-dimethylpiperidin-1-yl)-5-oxohexanoate |
|---|---|
| PubChem CID | 59392275 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-(2,6-dimethylpiperidin-1-yl)-5-oxohexanoate |
| SMILES | CC1CCCC(C)N1CC(=O)CCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C17H26N2O5/c1-12-5-3-6-13(2)18(12)11-14(20)7-4-8-17(23)24-19-15(21)9-10-16(19)22/h12-13H,3-11H2,1-2H3 |
| InChIKey | SHVBUEVWDGZXAO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|