C17H14F2N4O2 — CID 59403007
2,6-difluoro-3-[(5-methyl-2-phenyltriazol-4-yl)methoxy]benzamide (PubChem CID 59403007) has the molecular formula C17H14F2N4O2 and a molecular weight of 344.32 g/mol. Its IUPAC name is 2,6-difluoro-3-[(5-methyl-2-phenyltriazol-4-yl)methoxy]benzamide.
| Compound Name | 2,6-difluoro-3-[(5-methyl-2-phenyltriazol-4-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 59403007 |
| Molecular Formula | C17H14F2N4O2 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2,6-difluoro-3-[(5-methyl-2-phenyltriazol-4-yl)methoxy]benzamide |
| SMILES | Cc1nn(-c2ccccc2)nc1COc1ccc(F)c(C(N)=O)c1F |
| InChI | InChI=1S/C17H14F2N4O2/c1-10-13(22-23(21-10)11-5-3-2-4-6-11)9-25-14-8-7-12(18)15(16(14)19)17(20)24/h2-8H,9H2,1H3,(H2,20,24) |
| InChIKey | DXTBSCJTOGQYHG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |