C27H39N3O12Si — CID 59404534
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[3-[3,5-dioxo-10-(trimethoxysilylmethyl)-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propanoylamino]ethoxy]ethoxy]propanoate (PubChem CID 59404534) has the molecular formula C27H39N3O12Si and a molecular weight of 625.70 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[3-[3,5-dioxo-10-(trimethoxysilylmethyl)-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propanoylamino]ethoxy]ethoxy]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[3-[3,5-dioxo-10-(trimethoxysilylmethyl)-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propanoylamino]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 59404534 |
| Molecular Formula | C27H39N3O12Si |
| Molecular Weight | 625.70 g/mol |
| Exact Mass | 625.23 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[3-[3,5-dioxo-10-(trimethoxysilylmethyl)-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]propanoylamino]ethoxy]ethoxy]propanoate |
| SMILES | CO[Si](CC1C2C=CC1C1C(=O)N(CCC(=O)NCCOCCOCCC(=O)ON3C(=O)CCC3=O)C(=O)C21)(OC)OC |
| InChI | InChI=1S/C27H39N3O12Si/c1-37-43(38-2,39-3)16-19-17-4-5-18(19)25-24(17)26(35)29(27(25)36)11-8-20(31)28-10-13-41-15-14-40-12-9-23(34)42-30-21(32)6-7-22(30)33/h4-5,17-19,24-25H,6-16H2,1-3H3,(H,28,31) |
| InChIKey | SGIOSJYZXMSOGE-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 176.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.70 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|