C25H40N2O9Si — CID 70865927
3-[10-[[ethoxy(dimethoxy)silyl]methyl]-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-[2-[2-(3-oxobutoxy)ethoxy]ethyl]propanamide (PubChem CID 70865927) has the molecular formula C25H40N2O9Si and a molecular weight of 540.69 g/mol. Its IUPAC name is 3-[10-[[ethoxy(dimethoxy)silyl]methyl]-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-[2-[2-(3-oxobutoxy)ethoxy]ethyl]propanamide.
| Compound Name | 3-[10-[[ethoxy(dimethoxy)silyl]methyl]-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-[2-[2-(3-oxobutoxy)ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 70865927 |
| Molecular Formula | C25H40N2O9Si |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | 3-[10-[[ethoxy(dimethoxy)silyl]methyl]-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]-N-[2-[2-(3-oxobutoxy)ethoxy]ethyl]propanamide |
| SMILES | CCO[Si](CC1C2C=CC1C1C(=O)N(CCC(=O)NCCOCCOCCC(C)=O)C(=O)C21)(OC)OC |
| InChI | InChI=1S/C25H40N2O9Si/c1-5-36-37(32-3,33-4)16-20-18-6-7-19(20)23-22(18)24(30)27(25(23)31)11-8-21(29)26-10-13-35-15-14-34-12-9-17(2)28/h6-7,18-20,22-23H,5,8-16H2,1-4H3,(H,26,29) |
| InChIKey | TUJGOPDWNGAJEW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|