C16H31O6PS — CID 59408106
[(2R,3S,4S,5S)-3-[[(2R,3S,4S,5S)-3-methoxy-4,5-dimethyloxolan-2-yl]methoxy-methylphosphinothioyl]oxy-4,5-dimethyloxolan-2-yl]methanol (PubChem CID 59408106) has the molecular formula C16H31O6PS and a molecular weight of 382.46 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-3-[[(2R,3S,4S,5S)-3-methoxy-4,5-dimethyloxolan-2-yl]methoxy-methylphosphinothioyl]oxy-4,5-dimethyloxolan-2-yl]methanol.
| Compound Name | [(2R,3S,4S,5S)-3-[[(2R,3S,4S,5S)-3-methoxy-4,5-dimethyloxolan-2-yl]methoxy-methylphosphinothioyl]oxy-4,5-dimethyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 59408106 |
| Molecular Formula | C16H31O6PS |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | [(2R,3S,4S,5S)-3-[[(2R,3S,4S,5S)-3-methoxy-4,5-dimethyloxolan-2-yl]methoxy-methylphosphinothioyl]oxy-4,5-dimethyloxolan-2-yl]methanol |
| SMILES | CO[C@H]1[C@@H](C)[C@H](C)O[C@@H]1COP(C)(=S)O[C@H]1[C@@H](C)[C@H](C)O[C@@H]1CO |
| InChI | InChI=1S/C16H31O6PS/c1-9-11(3)21-14(15(9)18-5)8-19-23(6,24)22-16-10(2)12(4)20-13(16)7-17/h9-17H,7-8H2,1-6H3/t9-,10-,11-,12-,13+,14+,15-,16-,23?/m0/s1 |
| InChIKey | QGKIBLVBDYXGNF-NCTFQQEHSA-N |
| XLogP | 2.18 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|