C8H17ClO5P+ — CID 118595337
chloro-hydroxy-[2-(hydroxymethyl)-4,5-dimethyloxolan-3-yl]oxy-methoxyphosphanium (PubChem CID 118595337) has the molecular formula C8H17ClO5P+ and a molecular weight of 259.65 g/mol. Its IUPAC name is chloro-hydroxy-[2-(hydroxymethyl)-4,5-dimethyloxolan-3-yl]oxy-methoxyphosphanium.
| Compound Name | chloro-hydroxy-[2-(hydroxymethyl)-4,5-dimethyloxolan-3-yl]oxy-methoxyphosphanium |
|---|---|
| PubChem CID | 118595337 |
| Molecular Formula | C8H17ClO5P+ |
| Molecular Weight | 259.65 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | chloro-hydroxy-[2-(hydroxymethyl)-4,5-dimethyloxolan-3-yl]oxy-methoxyphosphanium |
| SMILES | CO[P+](O)(Cl)OC1C(CO)OC(C)C1C |
| InChI | InChI=1S/C8H17ClO5P/c1-5-6(2)13-7(4-10)8(5)14-15(9,11)12-3/h5-8,10-11H,4H2,1-3H3/q+1 |
| InChIKey | UTDPFLLQFCWAIM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.65 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|