C21H38O13P2-2 — CID 59154052
[(2R,3R,5S)-3-[[(2R,3R,5S)-3-hydroxy-4,5-dimethyloxolan-2-yl]methoxy-oxidophosphoryl]oxy-4,5-dimethyloxolan-2-yl]methyl [(2R,3R,5S)-2-(hydroxymethyl)-4,5-dimethyloxolan-3-yl] phosphate (PubChem CID 59154052) has the molecular formula C21H38O13P2-2 and a molecular weight of 560.47 g/mol. Its IUPAC name is [(2R,3R,5S)-3-[[(2R,3R,5S)-3-hydroxy-4,5-dimethyloxolan-2-yl]methoxy-oxidophosphoryl]oxy-4,5-dimethyloxolan-2-yl]methyl [(2R,3R,5S)-2-(hydroxymethyl)-4,5-dimethyloxolan-3-yl] phosphate.
| Compound Name | [(2R,3R,5S)-3-[[(2R,3R,5S)-3-hydroxy-4,5-dimethyloxolan-2-yl]methoxy-oxidophosphoryl]oxy-4,5-dimethyloxolan-2-yl]methyl [(2R,3R,5S)-2-(hydroxymethyl)-4,5-dimethyloxolan-3-yl] phosphate |
|---|---|
| PubChem CID | 59154052 |
| Molecular Formula | C21H38O13P2-2 |
| Molecular Weight | 560.47 g/mol |
| Exact Mass | 560.18 |
| IUPAC Name | [(2R,3R,5S)-3-[[(2R,3R,5S)-3-hydroxy-4,5-dimethyloxolan-2-yl]methoxy-oxidophosphoryl]oxy-4,5-dimethyloxolan-2-yl]methyl [(2R,3R,5S)-2-(hydroxymethyl)-4,5-dimethyloxolan-3-yl] phosphate |
| SMILES | CC1[C@H](C)O[C@H](COP(=O)([O-])O[C@@H]2C(C)[C@H](C)O[C@@H]2COP(=O)([O-])O[C@@H]2C(C)[C@H](C)O[C@@H]2CO)[C@@H]1O |
| InChI | InChI=1S/C21H40O13P2/c1-10-13(4)31-17(19(10)23)8-28-35(24,25)34-21-12(3)15(6)32-18(21)9-29-36(26,27)33-20-11(2)14(5)30-16(20)7-22/h10-23H,7-9H2,1-6H3,(H,24,25)(H,26,27)/p-2/t10?,11?,12?,13-,14-,15-,16+,17+,18+,19+,20+,21+/m0/s1 |
| InChIKey | KHLDEHVETSTVJT-PALYULJMSA-L |
| XLogP | 0.35 |
| TPSA | 185.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.47 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|