C14H28O10P2S — CID 59408121
[(2R,3S,4S,5S)-2-(dihydroxyphosphinothioyloxymethyl)-4,5-dimethyloxolan-3-yl] [(2R,3S,4R,5S)-3-hydroxy-4,5-dimethyloxolan-2-yl]methyl hydrogen phosphate (PubChem CID 59408121) has the molecular formula C14H28O10P2S and a molecular weight of 450.38 g/mol. Its IUPAC name is [(2R,3S,4S,5S)-2-(dihydroxyphosphinothioyloxymethyl)-4,5-dimethyloxolan-3-yl] [(2R,3S,4R,5S)-3-hydroxy-4,5-dimethyloxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | [(2R,3S,4S,5S)-2-(dihydroxyphosphinothioyloxymethyl)-4,5-dimethyloxolan-3-yl] [(2R,3S,4R,5S)-3-hydroxy-4,5-dimethyloxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 59408121 |
| Molecular Formula | C14H28O10P2S |
| Molecular Weight | 450.38 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | [(2R,3S,4S,5S)-2-(dihydroxyphosphinothioyloxymethyl)-4,5-dimethyloxolan-3-yl] [(2R,3S,4R,5S)-3-hydroxy-4,5-dimethyloxolan-2-yl]methyl hydrogen phosphate |
| SMILES | C[C@@H]1[C@H](O)[C@@H](COP(=O)(O)O[C@H]2[C@@H](C)[C@H](C)O[C@@H]2COP(O)(O)=S)O[C@H]1C |
| InChI | InChI=1S/C14H28O10P2S/c1-7-9(3)22-11(13(7)15)5-20-25(16,17)24-14-8(2)10(4)23-12(14)6-21-26(18,19)27/h7-15H,5-6H2,1-4H3,(H,16,17)(H2,18,19,27)/t7-,8-,9-,10-,11+,12+,13-,14-/m0/s1 |
| InChIKey | AOPYBVUGRMPPDI-OPEDVLRTSA-N |
| XLogP | 0.92 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|