C30H30N2O4S2Si — CID 59413635
bis[2-(5,5-dioxophenothiazin-10-yl)ethyl]-dimethylsilane (PubChem CID 59413635) has the molecular formula C30H30N2O4S2Si and a molecular weight of 574.80 g/mol. Its IUPAC name is bis[2-(5,5-dioxophenothiazin-10-yl)ethyl]-dimethylsilane.
| Compound Name | bis[2-(5,5-dioxophenothiazin-10-yl)ethyl]-dimethylsilane |
|---|---|
| PubChem CID | 59413635 |
| Molecular Formula | C30H30N2O4S2Si |
| Molecular Weight | 574.80 g/mol |
| Exact Mass | 574.14 |
| IUPAC Name | bis[2-(5,5-dioxophenothiazin-10-yl)ethyl]-dimethylsilane |
| SMILES | C[Si](C)(CCN1c2ccccc2S(=O)(=O)c2ccccc21)CCN1c2ccccc2S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C30H30N2O4S2Si/c1-39(2,21-19-31-23-11-3-7-15-27(23)37(33,34)28-16-8-4-12-24(28)31)22-20-32-25-13-5-9-17-29(25)38(35,36)30-18-10-6-14-26(30)32/h3-18H,19-22H2,1-2H3 |
| InChIKey | KPOHKCYDDUMYQB-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.80 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|