C14H12BrNO2S — CID 174917931
1-bromo-10-ethylphenothiazine 5,5-dioxide (PubChem CID 174917931) has the molecular formula C14H12BrNO2S and a molecular weight of 338.23 g/mol. Its IUPAC name is 1-bromo-10-ethylphenothiazine 5,5-dioxide.
| Compound Name | 1-bromo-10-ethylphenothiazine 5,5-dioxide |
|---|---|
| PubChem CID | 174917931 |
| Molecular Formula | C14H12BrNO2S |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | 1-bromo-10-ethylphenothiazine 5,5-dioxide |
| SMILES | CCN1c2ccccc2S(=O)(=O)c2cccc(Br)c21 |
| InChI | InChI=1S/C14H12BrNO2S/c1-2-16-11-7-3-4-8-12(11)19(17,18)13-9-5-6-10(15)14(13)16/h3-9H,2H2,1H3 |
| InChIKey | KATNBTRLQWKVKN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |