C18H22BrClN2O2S — CID 67713021
3-(2-chloro-5,5-dioxophenothiazin-10-yl)propyl-trimethylazanium bromide (PubChem CID 67713021) has the molecular formula C18H22BrClN2O2S and a molecular weight of 445.81 g/mol. Its IUPAC name is 3-(2-chloro-5,5-dioxophenothiazin-10-yl)propyl-trimethylazanium bromide.
| Compound Name | 3-(2-chloro-5,5-dioxophenothiazin-10-yl)propyl-trimethylazanium bromide |
|---|---|
| PubChem CID | 67713021 |
| Molecular Formula | C18H22BrClN2O2S |
| Molecular Weight | 445.81 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 3-(2-chloro-5,5-dioxophenothiazin-10-yl)propyl-trimethylazanium bromide |
| SMILES | C[N+](C)(C)CCCN1c2ccccc2S(=O)(=O)c2ccc(Cl)cc21.[Br-] |
| InChI | InChI=1S/C18H22ClN2O2S.BrH/c1-21(2,3)12-6-11-20-15-7-4-5-8-17(15)24(22,23)18-10-9-14(19)13-16(18)20;/h4-5,7-10,13H,6,11-12H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | WVQYLCVDWRGPNM-UHFFFAOYSA-M |
| XLogP | 0.72 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.81 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|