C22H26F3N7O2 — CID 59421875
1-butyl-N-(3-pyrazol-1-ylpropyl)-4-[[4-(trifluoromethyl)phenyl]carbamoylamino]imidazole-2-carboxamide (PubChem CID 59421875) has the molecular formula C22H26F3N7O2 and a molecular weight of 477.49 g/mol. Its IUPAC name is 1-butyl-N-(3-pyrazol-1-ylpropyl)-4-[[4-(trifluoromethyl)phenyl]carbamoylamino]imidazole-2-carboxamide.
| Compound Name | 1-butyl-N-(3-pyrazol-1-ylpropyl)-4-[[4-(trifluoromethyl)phenyl]carbamoylamino]imidazole-2-carboxamide |
|---|---|
| PubChem CID | 59421875 |
| Molecular Formula | C22H26F3N7O2 |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 1-butyl-N-(3-pyrazol-1-ylpropyl)-4-[[4-(trifluoromethyl)phenyl]carbamoylamino]imidazole-2-carboxamide |
| SMILES | CCCCn1cc(NC(=O)Nc2ccc(C(F)(F)F)cc2)nc1C(=O)NCCCn1cccn1 |
| InChI | InChI=1S/C22H26F3N7O2/c1-2-3-12-31-15-18(29-19(31)20(33)26-10-4-13-32-14-5-11-27-32)30-21(34)28-17-8-6-16(7-9-17)22(23,24)25/h5-9,11,14-15H,2-4,10,12-13H2,1H3,(H,26,33)(H2,28,30,34) |
| InChIKey | ADNKPCPANFMCER-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|